C20H22O2 — CID 101081255
(4-methyl-1,1-diphenylpent-1-en-3-yl) acetate (PubChem CID 101081255) has the molecular formula C20H22O2 and a molecular weight of 294.39 g/mol. Its IUPAC name is (4-methyl-1,1-diphenylpent-1-en-3-yl) acetate.
| Compound Name | (4-methyl-1,1-diphenylpent-1-en-3-yl) acetate |
|---|---|
| PubChem CID | 101081255 |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | (4-methyl-1,1-diphenylpent-1-en-3-yl) acetate |
| SMILES | CC(=O)OC(C=C(c1ccccc1)c1ccccc1)C(C)C |
| InChI | InChI=1S/C20H22O2/c1-15(2)20(22-16(3)21)14-19(17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4-15,20H,1-3H3 |
| InChIKey | GWESJKYYYZSDSM-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |