About 2-methyl-N,4,4-triphenylbut-3-enamide
2-methyl-N,4,4-triphenylbut-3-enamide (PubChem CID 134919204) has the molecular formula C23H21NO
and a molecular weight of 327.43 g/mol. Its IUPAC name is 2-methyl-N,4,4-triphenylbut-3-enamide.
Molecular Properties
| Compound Name | 2-methyl-N,4,4-triphenylbut-3-enamide |
| PubChem CID | 134919204 |
| Molecular Formula | C23H21NO |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 2-methyl-N,4,4-triphenylbut-3-enamide |
| SMILES | CC(C=C(c1ccccc1)c1ccccc1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C23H21NO/c1-18(23(25)24-21-15-9-4-10-16-21)17-22(19-11-5-2-6-12-19)20-13-7-3-8-14-20/h2-18H,1H3,(H,24,25) |
| InChIKey | CRWFUIWRLKNHNF-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methyl-N,4,4-triphenylbut-3-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N,4,4-triphenylbut-3-enamide?
The IUPAC name of 2-methyl-N,4,4-triphenylbut-3-enamide (CID 134919204) is 2-methyl-N,4,4-triphenylbut-3-enamide.
What is the SMILES notation for 2-methyl-N,4,4-triphenylbut-3-enamide?
The canonical SMILES for 2-methyl-N,4,4-triphenylbut-3-enamide is CC(C=C(c1ccccc1)c1ccccc1)C(=O)Nc1ccccc1.
What is the InChIKey of 2-methyl-N,4,4-triphenylbut-3-enamide?
The InChIKey is CRWFUIWRLKNHNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21NO/c1-18(23(25)24-21-15-9-4-10-16-21)17-22(19-11-5-2-6-12-19)20-13-7-3-8-14-20/h2-18H,1H3,(H,24,25).
What are the key properties of 2-methyl-N,4,4-triphenylbut-3-enamide?
2-methyl-N,4,4-triphenylbut-3-enamide has a molecular weight of 327.43 g/mol, XLogP of 5.39, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N,4,4-triphenylbut-3-enamide is sourced from PubChem (CID 134919204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).