C9H11IO5 — CID 10358991
(2R,3R,4S,4aR,8aR)-4-hydroxy-3-iodo-2-methoxy-3,4,4a,8a-tetrahydro-2H-pyrano[3,2-b]pyran-6-one (PubChem CID 10358991) has the molecular formula C9H11IO5 and a molecular weight of 326.09 g/mol. Its IUPAC name is (2R,3R,4S,4aR,8aR)-4-hydroxy-3-iodo-2-methoxy-3,4,4a,8a-tetrahydro-2H-pyrano[3,2-b]pyran-6-one.
| Compound Name | (2R,3R,4S,4aR,8aR)-4-hydroxy-3-iodo-2-methoxy-3,4,4a,8a-tetrahydro-2H-pyrano[3,2-b]pyran-6-one |
|---|---|
| PubChem CID | 10358991 |
| Molecular Formula | C9H11IO5 |
| Molecular Weight | 326.09 g/mol |
| Exact Mass | 325.97 |
| IUPAC Name | (2R,3R,4S,4aR,8aR)-4-hydroxy-3-iodo-2-methoxy-3,4,4a,8a-tetrahydro-2H-pyrano[3,2-b]pyran-6-one |
| SMILES | CO[C@@H]1O[C@@H]2C=CC(=O)O[C@@H]2[C@H](O)[C@H]1I |
| InChI | InChI=1S/C9H11IO5/c1-13-9-6(10)7(12)8-4(14-9)2-3-5(11)15-8/h2-4,6-9,12H,1H3/t4-,6-,7-,8+,9-/m1/s1 |
| InChIKey | LDPWXXWLMAXUMT-MULGLODXSA-N |
| XLogP | 0.00 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.09 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|