C19H20O7 — CID 52920721
[(E,2S,3R)-5-[(2R,3S,3aS,7aS)-3-hydroxy-5-oxo-2,3,3a,7a-tetrahydrofuro[3,2-b]pyran-2-yl]-3-hydroxypent-4-en-2-yl] benzoate (PubChem CID 52920721) has the molecular formula C19H20O7 and a molecular weight of 360.36 g/mol. Its IUPAC name is [(E,2S,3R)-5-[(2R,3S,3aS,7aS)-3-hydroxy-5-oxo-2,3,3a,7a-tetrahydrofuro[3,2-b]pyran-2-yl]-3-hydroxypent-4-en-2-yl] benzoate.
| Compound Name | [(E,2S,3R)-5-[(2R,3S,3aS,7aS)-3-hydroxy-5-oxo-2,3,3a,7a-tetrahydrofuro[3,2-b]pyran-2-yl]-3-hydroxypent-4-en-2-yl] benzoate |
|---|---|
| PubChem CID | 52920721 |
| Molecular Formula | C19H20O7 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | [(E,2S,3R)-5-[(2R,3S,3aS,7aS)-3-hydroxy-5-oxo-2,3,3a,7a-tetrahydrofuro[3,2-b]pyran-2-yl]-3-hydroxypent-4-en-2-yl] benzoate |
| SMILES | C[C@H](OC(=O)c1ccccc1)[C@H](O)/C=C/[C@H]1O[C@H]2C=CC(=O)O[C@H]2[C@H]1O |
| InChI | InChI=1S/C19H20O7/c1-11(24-19(23)12-5-3-2-4-6-12)13(20)7-8-14-17(22)18-15(25-14)9-10-16(21)26-18/h2-11,13-15,17-18,20,22H,1H3/b8-7+/t11-,13+,14+,15-,17-,18+/m0/s1 |
| InChIKey | GFGOREOOTIVQEM-JTIANQJDSA-N |
| XLogP | 0.76 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|