C16H22O9 — CID 163071586
[(E,2S,3R,6S,7S)-3-acetyloxy-6,7-dihydroxy-7-[(2R,3S)-3-hydroxy-6-oxo-2,3-dihydropyran-2-yl]hept-4-en-2-yl] acetate (PubChem CID 163071586) has the molecular formula C16H22O9 and a molecular weight of 358.34 g/mol. Its IUPAC name is [(E,2S,3R,6S,7S)-3-acetyloxy-6,7-dihydroxy-7-[(2R,3S)-3-hydroxy-6-oxo-2,3-dihydropyran-2-yl]hept-4-en-2-yl] acetate.
| Compound Name | [(E,2S,3R,6S,7S)-3-acetyloxy-6,7-dihydroxy-7-[(2R,3S)-3-hydroxy-6-oxo-2,3-dihydropyran-2-yl]hept-4-en-2-yl] acetate |
|---|---|
| PubChem CID | 163071586 |
| Molecular Formula | C16H22O9 |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | [(E,2S,3R,6S,7S)-3-acetyloxy-6,7-dihydroxy-7-[(2R,3S)-3-hydroxy-6-oxo-2,3-dihydropyran-2-yl]hept-4-en-2-yl] acetate |
| SMILES | CC(=O)O[C@@H](C)[C@@H](/C=C/[C@H](O)[C@H](O)[C@@H]1OC(=O)C=C[C@@H]1O)OC(C)=O |
| InChI | InChI=1S/C16H22O9/c1-8(23-9(2)17)13(24-10(3)18)6-4-11(19)15(22)16-12(20)5-7-14(21)25-16/h4-8,11-13,15-16,19-20,22H,1-3H3/b6-4+/t8-,11-,12-,13+,15-,16+/m0/s1 |
| InChIKey | PCDJZLPEHZPIJA-SIDSEQNVSA-N |
| XLogP | -1.01 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|