C16H24O8 — CID 75052020
[2-(3-acetyloxy-1,2-dihydroxyheptyl)-6-oxo-2,3-dihydropyran-3-yl] acetate (PubChem CID 75052020) has the molecular formula C16H24O8 and a molecular weight of 344.36 g/mol. Its IUPAC name is [2-(3-acetyloxy-1,2-dihydroxyheptyl)-6-oxo-2,3-dihydropyran-3-yl] acetate.
| Compound Name | [2-(3-acetyloxy-1,2-dihydroxyheptyl)-6-oxo-2,3-dihydropyran-3-yl] acetate |
|---|---|
| PubChem CID | 75052020 |
| Molecular Formula | C16H24O8 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | [2-(3-acetyloxy-1,2-dihydroxyheptyl)-6-oxo-2,3-dihydropyran-3-yl] acetate |
| SMILES | CCCCC(OC(C)=O)C(O)C(O)C1OC(=O)C=CC1OC(C)=O |
| InChI | InChI=1S/C16H24O8/c1-4-5-6-11(22-9(2)17)14(20)15(21)16-12(23-10(3)18)7-8-13(19)24-16/h7-8,11-12,14-16,20-21H,4-6H2,1-3H3 |
| InChIKey | ORQWRPPDEKYPHP-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|