C18H20O9 — CID 126551818
[2-[(2S,3S)-3-[(E,3R,4S)-3,4-diacetyloxypent-1-enyl]oxiran-2-yl]-6-oxopyran-3-yl] acetate (PubChem CID 126551818) has the molecular formula C18H20O9 and a molecular weight of 380.35 g/mol. Its IUPAC name is [2-[(2S,3S)-3-[(E,3R,4S)-3,4-diacetyloxypent-1-enyl]oxiran-2-yl]-6-oxopyran-3-yl] acetate.
| Compound Name | [2-[(2S,3S)-3-[(E,3R,4S)-3,4-diacetyloxypent-1-enyl]oxiran-2-yl]-6-oxopyran-3-yl] acetate |
|---|---|
| PubChem CID | 126551818 |
| Molecular Formula | C18H20O9 |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | [2-[(2S,3S)-3-[(E,3R,4S)-3,4-diacetyloxypent-1-enyl]oxiran-2-yl]-6-oxopyran-3-yl] acetate |
| SMILES | CC(=O)Oc1ccc(=O)oc1[C@H]1O[C@H]1/C=C/[C@@H](OC(C)=O)[C@H](C)OC(C)=O |
| InChI | InChI=1S/C18H20O9/c1-9(23-10(2)19)13(24-11(3)20)5-6-15-17(26-15)18-14(25-12(4)21)7-8-16(22)27-18/h5-9,13,15,17H,1-4H3/b6-5+/t9-,13+,15-,17-/m0/s1 |
| InChIKey | XHPYXUGMNQBGKQ-CMGBGFIFSA-N |
| XLogP | 1.44 |
| TPSA | 121.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|