About (2-oxochromen-5-yl) acetate
(2-oxochromen-5-yl) acetate (PubChem CID 12853206) has the molecular formula C11H8O4
and a molecular weight of 204.18 g/mol. Its IUPAC name is (2-oxochromen-5-yl) acetate.
Molecular Properties
| Compound Name | (2-oxochromen-5-yl) acetate |
| PubChem CID | 12853206 |
| Molecular Formula | C11H8O4 |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.04 |
| IUPAC Name | (2-oxochromen-5-yl) acetate |
| SMILES | CC(=O)Oc1cccc2oc(=O)ccc12 |
| InChI | InChI=1S/C11H8O4/c1-7(12)14-9-3-2-4-10-8(9)5-6-11(13)15-10/h2-6H,1H3 |
| InChIKey | HAQXYXKAQHBQCA-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-oxochromen-5-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxochromen-5-yl) acetate?
The IUPAC name of (2-oxochromen-5-yl) acetate (CID 12853206) is (2-oxochromen-5-yl) acetate.
What is the SMILES notation for (2-oxochromen-5-yl) acetate?
The canonical SMILES for (2-oxochromen-5-yl) acetate is CC(=O)Oc1cccc2oc(=O)ccc12.
What is the InChIKey of (2-oxochromen-5-yl) acetate?
The InChIKey is HAQXYXKAQHBQCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8O4/c1-7(12)14-9-3-2-4-10-8(9)5-6-11(13)15-10/h2-6H,1H3.
What are the key properties of (2-oxochromen-5-yl) acetate?
(2-oxochromen-5-yl) acetate has a molecular weight of 204.18 g/mol, XLogP of 1.72, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxochromen-5-yl) acetate is sourced from PubChem (CID 12853206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).