About 1-benzofuran-3-yl acetate
1-benzofuran-3-yl acetate (PubChem CID 2769621) has the molecular formula C10H8O3
and a molecular weight of 176.17 g/mol. Its IUPAC name is 1-benzofuran-3-yl acetate.
Molecular Properties
| Compound Name | 1-benzofuran-3-yl acetate |
| PubChem CID | 2769621 |
| Molecular Formula | C10H8O3 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.05 |
| IUPAC Name | 1-benzofuran-3-yl acetate |
| SMILES | CC(=O)Oc1coc2ccccc12 |
| InChI | InChI=1S/C10H8O3/c1-7(11)13-10-6-12-9-5-3-2-4-8(9)10/h2-6H,1H3 |
| InChIKey | XCBLZAJCKKRBED-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-benzofuran-3-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzofuran-3-yl acetate?
The IUPAC name of 1-benzofuran-3-yl acetate (CID 2769621) is 1-benzofuran-3-yl acetate.
What is the SMILES notation for 1-benzofuran-3-yl acetate?
The canonical SMILES for 1-benzofuran-3-yl acetate is CC(=O)Oc1coc2ccccc12.
What is the InChIKey of 1-benzofuran-3-yl acetate?
The InChIKey is XCBLZAJCKKRBED-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O3/c1-7(11)13-10-6-12-9-5-3-2-4-8(9)10/h2-6H,1H3.
What are the key properties of 1-benzofuran-3-yl acetate?
1-benzofuran-3-yl acetate has a molecular weight of 176.17 g/mol, XLogP of 2.36, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzofuran-3-yl acetate is sourced from PubChem (CID 2769621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).