About 5-hydroxychromen-2-one
5-hydroxychromen-2-one (PubChem CID 5318179) has the molecular formula C9H6O3
and a molecular weight of 162.14 g/mol. Its IUPAC name is 5-hydroxychromen-2-one.
Molecular Properties
| Compound Name | 5-hydroxychromen-2-one |
| PubChem CID | 5318179 |
| Molecular Formula | C9H6O3 |
| Molecular Weight | 162.14 g/mol |
| Exact Mass | 162.03 |
| IUPAC Name | 5-hydroxychromen-2-one |
| SMILES | O=c1ccc2c(O)cccc2o1 |
| InChI | InChI=1S/C9H6O3/c10-7-2-1-3-8-6(7)4-5-9(11)12-8/h1-5,10H |
| InChIKey | CDHSCTCRBLLCBJ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.14 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxychromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxychromen-2-one?
The IUPAC name of 5-hydroxychromen-2-one (CID 5318179) is 5-hydroxychromen-2-one.
What is the SMILES notation for 5-hydroxychromen-2-one?
The canonical SMILES for 5-hydroxychromen-2-one is O=c1ccc2c(O)cccc2o1.
What is the InChIKey of 5-hydroxychromen-2-one?
The InChIKey is CDHSCTCRBLLCBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6O3/c10-7-2-1-3-8-6(7)4-5-9(11)12-8/h1-5,10H.
What are the key properties of 5-hydroxychromen-2-one?
5-hydroxychromen-2-one has a molecular weight of 162.14 g/mol, XLogP of 1.50, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxychromen-2-one is sourced from PubChem (CID 5318179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).