C9H6CuO2 — CID 175033656
chromen-2-one;copper (PubChem CID 175033656) has the molecular formula C9H6CuO2 and a molecular weight of 209.69 g/mol. Its IUPAC name is chromen-2-one;copper.
| Compound Name | chromen-2-one;copper |
|---|---|
| PubChem CID | 175033656 |
| Molecular Formula | C9H6CuO2 |
| Molecular Weight | 209.69 g/mol |
| Exact Mass | 208.97 |
| IUPAC Name | chromen-2-one;copper |
| SMILES | O=c1ccc2ccccc2o1.[Cu] |
| InChI | InChI=1S/C9H6O2.Cu/c10-9-6-5-7-3-1-2-4-8(7)11-9;/h1-6H; |
| InChIKey | ZWDXIZYFPREHKR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.69 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|