About chromen-2-one;bis(prop-2-enoic acid)
chromen-2-one;bis(prop-2-enoic acid) (PubChem CID 175490612) has the molecular formula C15H14O6
and a molecular weight of 290.27 g/mol. Its IUPAC name is chromen-2-one;bis(prop-2-enoic acid).
Molecular Properties
| Compound Name | chromen-2-one;bis(prop-2-enoic acid) |
| PubChem CID | 175490612 |
| Molecular Formula | C15H14O6 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | chromen-2-one;bis(prop-2-enoic acid) |
| SMILES | C=CC(=O)O.C=CC(=O)O.O=c1ccc2ccccc2o1 |
| InChI | InChI=1S/C9H6O2.2C3H4O2/c10-9-6-5-7-3-1-2-4-8(7)11-9;2*1-2-3(4)5/h1-6H;2*2H,1H2,(H,4,5) |
| InChIKey | GVZQPZCMXSWMAP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze chromen-2-one;bis(prop-2-enoic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromen-2-one;bis(prop-2-enoic acid)?
The IUPAC name of chromen-2-one;bis(prop-2-enoic acid) (CID 175490612) is chromen-2-one;bis(prop-2-enoic acid).
What is the SMILES notation for chromen-2-one;bis(prop-2-enoic acid)?
The canonical SMILES for chromen-2-one;bis(prop-2-enoic acid) is C=CC(=O)O.C=CC(=O)O.O=c1ccc2ccccc2o1.
What is the InChIKey of chromen-2-one;bis(prop-2-enoic acid)?
The InChIKey is GVZQPZCMXSWMAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6O2.2C3H4O2/c10-9-6-5-7-3-1-2-4-8(7)11-9;2*1-2-3(4)5/h1-6H;2*2H,1H2,(H,4,5).
What are the key properties of chromen-2-one;bis(prop-2-enoic acid)?
chromen-2-one;bis(prop-2-enoic acid) has a molecular weight of 290.27 g/mol, XLogP of 2.31, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for chromen-2-one;bis(prop-2-enoic acid) is sourced from PubChem (CID 175490612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).