About chromen-2-one;1,4-dioxine
chromen-2-one;1,4-dioxine (PubChem CID 175414540) has the molecular formula C13H10O4
and a molecular weight of 230.22 g/mol. Its IUPAC name is chromen-2-one;1,4-dioxine.
Molecular Properties
| Compound Name | chromen-2-one;1,4-dioxine |
| PubChem CID | 175414540 |
| Molecular Formula | C13H10O4 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | chromen-2-one;1,4-dioxine |
| SMILES | C1=COC=CO1.O=c1ccc2ccccc2o1 |
| InChI | InChI=1S/C9H6O2.C4H4O2/c10-9-6-5-7-3-1-2-4-8(7)11-9;1-2-6-4-3-5-1/h1-6H;1-4H |
| InChIKey | ANNVHJSLJLCKSL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze chromen-2-one;1,4-dioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromen-2-one;1,4-dioxine?
The IUPAC name of chromen-2-one;1,4-dioxine (CID 175414540) is chromen-2-one;1,4-dioxine.
What is the SMILES notation for chromen-2-one;1,4-dioxine?
The canonical SMILES for chromen-2-one;1,4-dioxine is C1=COC=CO1.O=c1ccc2ccccc2o1.
What is the InChIKey of chromen-2-one;1,4-dioxine?
The InChIKey is ANNVHJSLJLCKSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6O2.C4H4O2/c10-9-6-5-7-3-1-2-4-8(7)11-9;1-2-6-4-3-5-1/h1-6H;1-4H.
What are the key properties of chromen-2-one;1,4-dioxine?
chromen-2-one;1,4-dioxine has a molecular weight of 230.22 g/mol, XLogP of 2.77, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for chromen-2-one;1,4-dioxine is sourced from PubChem (CID 175414540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).