About 1'-Acetoxychavicol Acetate
1'-Acetoxychavicol Acetate (PubChem CID 119104) has the molecular formula C13H14O4
and a molecular weight of 234.25 g/mol. Its IUPAC name is [4-[(1S)-1-acetyloxyprop-2-enyl]phenyl] acetate.
Molecular Properties
| Compound Name | 1'-Acetoxychavicol Acetate |
| PubChem CID | 119104 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | [4-[(1S)-1-acetyloxyprop-2-enyl]phenyl] acetate |
| SMILES | CC(=O)OC1=CC=C(C=C1)[C@H](C=C)OC(=O)C |
| InChI | InChI=1S/C13H14O4/c1-4-13(17-10(3)15)11-5-7-12(8-6-11)16-9(2)14/h4-8,13H,1H2,2-3H3/t13-/m0/s1 |
| InChIKey | JAMQIUWGGBSIKZ-ZDUSSCGKSA-N |
| XLogP | 2.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | 290 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 1'-Acetoxychavicol Acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-Acetoxychavicol Acetate?
The IUPAC name of 1'-Acetoxychavicol Acetate (CID 119104) is [4-[(1S)-1-acetyloxyprop-2-enyl]phenyl] acetate.
What is the SMILES notation for 1'-Acetoxychavicol Acetate?
The canonical SMILES for 1'-Acetoxychavicol Acetate is CC(=O)OC1=CC=C(C=C1)[C@H](C=C)OC(=O)C.
What is the InChIKey of 1'-Acetoxychavicol Acetate?
The InChIKey is JAMQIUWGGBSIKZ-ZDUSSCGKSA-N. The full InChI is InChI=1S/C13H14O4/c1-4-13(17-10(3)15)11-5-7-12(8-6-11)16-9(2)14/h4-8,13H,1H2,2-3H3/t13-/m0/s1.
What are the key properties of 1'-Acetoxychavicol Acetate?
1'-Acetoxychavicol Acetate has a molecular weight of 234.25 g/mol, XLogP of 2.20, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-Acetoxychavicol Acetate is sourced from PubChem (CID 119104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).