About Eugenyl Acetate
Eugenyl Acetate (PubChem CID 7136) has the molecular formula C12H14O3
and a molecular weight of 206.24 g/mol. Its IUPAC name is (2-methoxy-4-prop-2-enylphenyl) acetate.
Molecular Properties
| Compound Name | Eugenyl Acetate |
| PubChem CID | 7136 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (2-methoxy-4-prop-2-enylphenyl) acetate |
| SMILES | CC(=O)OC1=C(C=C(C=C1)CC=C)OC |
| InChI | InChI=1S/C12H14O3/c1-4-5-10-6-7-11(15-9(2)13)12(8-10)14-3/h4,6-8H,1,5H2,2-3H3 |
| InChIKey | SCCDQYPEOIRVGX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | 225 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze Eugenyl Acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Eugenyl Acetate?
The IUPAC name of Eugenyl Acetate (CID 7136) is (2-methoxy-4-prop-2-enylphenyl) acetate.
What is the SMILES notation for Eugenyl Acetate?
The canonical SMILES for Eugenyl Acetate is CC(=O)OC1=C(C=C(C=C1)CC=C)OC.
What is the InChIKey of Eugenyl Acetate?
The InChIKey is SCCDQYPEOIRVGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O3/c1-4-5-10-6-7-11(15-9(2)13)12(8-10)14-3/h4,6-8H,1,5H2,2-3H3.
What are the key properties of Eugenyl Acetate?
Eugenyl Acetate has a molecular weight of 206.24 g/mol, XLogP of 2.30, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Eugenyl Acetate is sourced from PubChem (CID 7136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).