About chromen-2-one;N-methylprop-2-enamide
chromen-2-one;N-methylprop-2-enamide (PubChem CID 175576112) has the molecular formula C13H13NO3
and a molecular weight of 231.25 g/mol. Its IUPAC name is chromen-2-one;N-methylprop-2-enamide.
Molecular Properties
| Compound Name | chromen-2-one;N-methylprop-2-enamide |
| PubChem CID | 175576112 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | chromen-2-one;N-methylprop-2-enamide |
| SMILES | C=CC(=O)NC.O=c1ccc2ccccc2o1 |
| InChI | InChI=1S/C9H6O2.C4H7NO/c10-9-6-5-7-3-1-2-4-8(7)11-9;1-3-4(6)5-2/h1-6H;3H,1H2,2H3,(H,5,6) |
| InChIKey | WHOOAKCKVCYBKF-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze chromen-2-one;N-methylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromen-2-one;N-methylprop-2-enamide?
The IUPAC name of chromen-2-one;N-methylprop-2-enamide (CID 175576112) is chromen-2-one;N-methylprop-2-enamide.
What is the SMILES notation for chromen-2-one;N-methylprop-2-enamide?
The canonical SMILES for chromen-2-one;N-methylprop-2-enamide is C=CC(=O)NC.O=c1ccc2ccccc2o1.
What is the InChIKey of chromen-2-one;N-methylprop-2-enamide?
The InChIKey is WHOOAKCKVCYBKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6O2.C4H7NO/c10-9-6-5-7-3-1-2-4-8(7)11-9;1-3-4(6)5-2/h1-6H;3H,1H2,2H3,(H,5,6).
What are the key properties of chromen-2-one;N-methylprop-2-enamide?
chromen-2-one;N-methylprop-2-enamide has a molecular weight of 231.25 g/mol, XLogP of 1.71, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for chromen-2-one;N-methylprop-2-enamide is sourced from PubChem (CID 175576112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).