About chromen-2-one;undecan-2-one
chromen-2-one;undecan-2-one (PubChem CID 163846600) has the molecular formula C20H28O3
and a molecular weight of 316.44 g/mol. Its IUPAC name is chromen-2-one;undecan-2-one.
Molecular Properties
| Compound Name | chromen-2-one;undecan-2-one |
| PubChem CID | 163846600 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | chromen-2-one;undecan-2-one |
| SMILES | CCCCCCCCCC(C)=O.O=c1ccc2ccccc2o1 |
| InChI | InChI=1S/C11H22O.C9H6O2/c1-3-4-5-6-7-8-9-10-11(2)12;10-9-6-5-7-3-1-2-4-8(7)11-9/h3-10H2,1-2H3;1-6H |
| InChIKey | OQSZLMTVUAGKSH-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze chromen-2-one;undecan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromen-2-one;undecan-2-one?
The IUPAC name of chromen-2-one;undecan-2-one (CID 163846600) is chromen-2-one;undecan-2-one.
What is the SMILES notation for chromen-2-one;undecan-2-one?
The canonical SMILES for chromen-2-one;undecan-2-one is CCCCCCCCCC(C)=O.O=c1ccc2ccccc2o1.
What is the InChIKey of chromen-2-one;undecan-2-one?
The InChIKey is OQSZLMTVUAGKSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O.C9H6O2/c1-3-4-5-6-7-8-9-10-11(2)12;10-9-6-5-7-3-1-2-4-8(7)11-9/h3-10H2,1-2H3;1-6H.
What are the key properties of chromen-2-one;undecan-2-one?
chromen-2-one;undecan-2-one has a molecular weight of 316.44 g/mol, XLogP of 5.51, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for chromen-2-one;undecan-2-one is sourced from PubChem (CID 163846600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).