C17H12N2O2 — CID 174951370
chromen-2-one;quinoxaline (PubChem CID 174951370) has the molecular formula C17H12N2O2 and a molecular weight of 276.30 g/mol. Its IUPAC name is chromen-2-one;quinoxaline.
| Compound Name | chromen-2-one;quinoxaline |
|---|---|
| PubChem CID | 174951370 |
| Molecular Formula | C17H12N2O2 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | chromen-2-one;quinoxaline |
| SMILES | O=c1ccc2ccccc2o1.c1ccc2nccnc2c1 |
| InChI | InChI=1S/C9H6O2.C8H6N2/c10-9-6-5-7-3-1-2-4-8(7)11-9;1-2-4-8-7(3-1)9-5-6-10-8/h1-6H;1-6H |
| InChIKey | GATWAIVHQZTXGA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|