C12H11NO3 — CID 174885895
chromen-2-one;4,5-dihydro-1,2-oxazole (PubChem CID 174885895) has the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. Its IUPAC name is chromen-2-one;4,5-dihydro-1,2-oxazole.
| Compound Name | chromen-2-one;4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 174885895 |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | chromen-2-one;4,5-dihydro-1,2-oxazole |
| SMILES | C1=NOCC1.O=c1ccc2ccccc2o1 |
| InChI | InChI=1S/C9H6O2.C3H5NO/c10-9-6-5-7-3-1-2-4-8(7)11-9;1-2-4-5-3-1/h1-6H;2H,1,3H2 |
| InChIKey | XRZWYPNHRHAWST-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 51.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|