About chromen-2-one;oxepan-2-one;oxolan-2-one
chromen-2-one;oxepan-2-one;oxolan-2-one (PubChem CID 158985869) has the molecular formula C19H22O6
and a molecular weight of 346.38 g/mol. Its IUPAC name is chromen-2-one;oxepan-2-one;oxolan-2-one.
Molecular Properties
| Compound Name | chromen-2-one;oxepan-2-one;oxolan-2-one |
| PubChem CID | 158985869 |
| Molecular Formula | C19H22O6 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | chromen-2-one;oxepan-2-one;oxolan-2-one |
| SMILES | O=C1CCCCCO1.O=C1CCCO1.O=c1ccc2ccccc2o1 |
| InChI | InChI=1S/C9H6O2.C6H10O2.C4H6O2/c10-9-6-5-7-3-1-2-4-8(7)11-9;7-6-4-2-1-3-5-8-6;5-4-2-1-3-6-4/h1-6H;1-5H2;1-3H2 |
| InChIKey | JPOGYJDEBQWFJC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze chromen-2-one;oxepan-2-one;oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromen-2-one;oxepan-2-one;oxolan-2-one?
The IUPAC name of chromen-2-one;oxepan-2-one;oxolan-2-one (CID 158985869) is chromen-2-one;oxepan-2-one;oxolan-2-one.
What is the SMILES notation for chromen-2-one;oxepan-2-one;oxolan-2-one?
The canonical SMILES for chromen-2-one;oxepan-2-one;oxolan-2-one is O=C1CCCCCO1.O=C1CCCO1.O=c1ccc2ccccc2o1.
What is the InChIKey of chromen-2-one;oxepan-2-one;oxolan-2-one?
The InChIKey is JPOGYJDEBQWFJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6O2.C6H10O2.C4H6O2/c10-9-6-5-7-3-1-2-4-8(7)11-9;7-6-4-2-1-3-5-8-6;5-4-2-1-3-6-4/h1-6H;1-5H2;1-3H2.
What are the key properties of chromen-2-one;oxepan-2-one;oxolan-2-one?
chromen-2-one;oxepan-2-one;oxolan-2-one has a molecular weight of 346.38 g/mol, XLogP of 3.22, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for chromen-2-one;oxepan-2-one;oxolan-2-one is sourced from PubChem (CID 158985869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).