C14H17NO2 — CID 162207704
chromen-2-one;piperidine (PubChem CID 162207704) has the molecular formula C14H17NO2 and a molecular weight of 231.30 g/mol. Its IUPAC name is chromen-2-one;piperidine.
| Compound Name | chromen-2-one;piperidine |
|---|---|
| PubChem CID | 162207704 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | chromen-2-one;piperidine |
| SMILES | C1CCNCC1.O=c1ccc2ccccc2o1 |
| InChI | InChI=1S/C9H6O2.C5H11N/c10-9-6-5-7-3-1-2-4-8(7)11-9;1-2-4-6-5-3-1/h1-6H;6H,1-5H2 |
| InChIKey | ZSKPNYDTKONSHA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|