C14H12O3 — CID 174615885
chromen-2-one;3-methylfuran (PubChem CID 174615885) has the molecular formula C14H12O3 and a molecular weight of 228.25 g/mol. Its IUPAC name is chromen-2-one;3-methylfuran.
| Compound Name | chromen-2-one;3-methylfuran |
|---|---|
| PubChem CID | 174615885 |
| Molecular Formula | C14H12O3 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | chromen-2-one;3-methylfuran |
| SMILES | Cc1ccoc1.O=c1ccc2ccccc2o1 |
| InChI | InChI=1S/C9H6O2.C5H6O/c10-9-6-5-7-3-1-2-4-8(7)11-9;1-5-2-3-6-4-5/h1-6H;2-4H,1H3 |
| InChIKey | HSJVLFQJTIZXQB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|