C9H8NO4S- — CID 155018405
CID 155018405 (PubChem CID 155018405) has the molecular formula C9H8NO4S- and a molecular weight of 226.23 g/mol.
| Compound Name | CID 155018405 |
|---|---|
| PubChem CID | 155018405 |
| Molecular Formula | C9H8NO4S- |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.02 |
| IUPAC Name | — |
| SMILES | NS(=O)[O-].O=c1ccc2ccccc2o1 |
| InChI | InChI=1S/C9H6O2.H3NO2S/c10-9-6-5-7-3-1-2-4-8(7)11-9;1-4(2)3/h1-6H;1H2,(H,2,3)/p-1 |
| InChIKey | NOBQZVLGDLGXDW-UHFFFAOYSA-M |
| XLogP | 0.53 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|