About CID 130237859
CID 130237859 (PubChem CID 130237859) has the molecular formula C16H12NO2S-
and a molecular weight of 282.34 g/mol.
Molecular Properties
| Compound Name | CID 130237859 |
| PubChem CID | 130237859 |
| Molecular Formula | C16H12NO2S- |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | — |
| SMILES | NS(=O)[O-].c1cc2ccc3cccc4ccc(c1)c2c34 |
| InChI | InChI=1S/C16H10.H3NO2S/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14;1-4(2)3/h1-10H;1H2,(H,2,3)/p-1 |
| InChIKey | LQSKGIGMEFEYEX-UHFFFAOYSA-M |
| XLogP | 3.32 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze CID 130237859 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 130237859?
The IUPAC name of CID 130237859 (CID 130237859) is not available.
What is the SMILES notation for CID 130237859?
The canonical SMILES for CID 130237859 is NS(=O)[O-].c1cc2ccc3cccc4ccc(c1)c2c34.
What is the InChIKey of CID 130237859?
The InChIKey is LQSKGIGMEFEYEX-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H10.H3NO2S/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14;1-4(2)3/h1-10H;1H2,(H,2,3)/p-1.
What are the key properties of CID 130237859?
CID 130237859 has a molecular weight of 282.34 g/mol, XLogP of 3.32, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 130237859 is sourced from PubChem (CID 130237859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).