C14H9NO3 — CID 42644773
benzo[d][1,3,7]benzodioxazonin-6-one (PubChem CID 42644773) has the molecular formula C14H9NO3 and a molecular weight of 239.23 g/mol. Its IUPAC name is benzo[d][1,3,7]benzodioxazonin-6-one.
| Compound Name | benzo[d][1,3,7]benzodioxazonin-6-one |
|---|---|
| PubChem CID | 42644773 |
| Molecular Formula | C14H9NO3 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | benzo[d][1,3,7]benzodioxazonin-6-one |
| SMILES | O=c1oc2ccccc2cnc2ccccc2o1 |
| InChI | InChI=1S/C14H9NO3/c16-14-17-12-7-3-1-5-10(12)9-15-11-6-2-4-8-13(11)18-14/h1-9H/b15-9- |
| InChIKey | HMJFSKWOEBFVBY-DHDCSXOGSA-N |
| XLogP | 3.06 |
| TPSA | 56.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |