C12H7NO2 — CID 44521863
pyrano[3,2-c]isoquinolin-2-one (PubChem CID 44521863) has the molecular formula C12H7NO2 and a molecular weight of 197.19 g/mol. Its IUPAC name is pyrano[3,2-c]isoquinolin-2-one.
| Compound Name | pyrano[3,2-c]isoquinolin-2-one |
|---|---|
| PubChem CID | 44521863 |
| Molecular Formula | C12H7NO2 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | pyrano[3,2-c]isoquinolin-2-one |
| SMILES | O=c1ccc2ncc3ccccc3c2o1 |
| InChI | InChI=1S/C12H7NO2/c14-11-6-5-10-12(15-11)9-4-2-1-3-8(9)7-13-10/h1-7H |
| InChIKey | ADERHXFEQTUVML-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|