C11H6N2O2 — CID 141055478
pyrido[2,3-h][1,4]benzoxazin-2-one (PubChem CID 141055478) has the molecular formula C11H6N2O2 and a molecular weight of 198.18 g/mol. Its IUPAC name is pyrido[2,3-h][1,4]benzoxazin-2-one.
| Compound Name | pyrido[2,3-h][1,4]benzoxazin-2-one |
|---|---|
| PubChem CID | 141055478 |
| Molecular Formula | C11H6N2O2 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | pyrido[2,3-h][1,4]benzoxazin-2-one |
| SMILES | O=c1cnc2ccc3ncccc3c2o1 |
| InChI | InChI=1S/C11H6N2O2/c14-10-6-13-9-4-3-8-7(11(9)15-10)2-1-5-12-8/h1-6H |
| InChIKey | GWEMNTSGPKINGA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|