C12H8N2O2 — CID 142239551
4-methylpyrido[2,3-h][1,3]benzoxazin-2-one (PubChem CID 142239551) has the molecular formula C12H8N2O2 and a molecular weight of 212.21 g/mol. Its IUPAC name is 4-methylpyrido[2,3-h][1,3]benzoxazin-2-one.
| Compound Name | 4-methylpyrido[2,3-h][1,3]benzoxazin-2-one |
|---|---|
| PubChem CID | 142239551 |
| Molecular Formula | C12H8N2O2 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 4-methylpyrido[2,3-h][1,3]benzoxazin-2-one |
| SMILES | Cc1nc(=O)oc2c1ccc1ncccc12 |
| InChI | InChI=1S/C12H8N2O2/c1-7-8-4-5-10-9(3-2-6-13-10)11(8)16-12(15)14-7/h2-6H,1H3 |
| InChIKey | BWKUWNICDCUESO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|