C18H12N2O3 — CID 10870421
2-(4-methoxyphenyl)pyrido[2,3-h][3,1]benzoxazin-4-one (PubChem CID 10870421) has the molecular formula C18H12N2O3 and a molecular weight of 304.31 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)pyrido[2,3-h][3,1]benzoxazin-4-one.
| Compound Name | 2-(4-methoxyphenyl)pyrido[2,3-h][3,1]benzoxazin-4-one |
|---|---|
| PubChem CID | 10870421 |
| Molecular Formula | C18H12N2O3 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 2-(4-methoxyphenyl)pyrido[2,3-h][3,1]benzoxazin-4-one |
| SMILES | COc1ccc(-c2nc3c(ccc4ncccc43)c(=O)o2)cc1 |
| InChI | InChI=1S/C18H12N2O3/c1-22-12-6-4-11(5-7-12)17-20-16-13-3-2-10-19-15(13)9-8-14(16)18(21)23-17/h2-10H,1H3 |
| InChIKey | CEDVAAQCVKSBRV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|