C15H11ClN2O — CID 102291117
7-chloro-5-(4-methoxyphenyl)-1,6-naphthyridine (PubChem CID 102291117) has the molecular formula C15H11ClN2O and a molecular weight of 270.72 g/mol. Its IUPAC name is 7-chloro-5-(4-methoxyphenyl)-1,6-naphthyridine.
| Compound Name | 7-chloro-5-(4-methoxyphenyl)-1,6-naphthyridine |
|---|---|
| PubChem CID | 102291117 |
| Molecular Formula | C15H11ClN2O |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 7-chloro-5-(4-methoxyphenyl)-1,6-naphthyridine |
| SMILES | COc1ccc(-c2nc(Cl)cc3ncccc23)cc1 |
| InChI | InChI=1S/C15H11ClN2O/c1-19-11-6-4-10(5-7-11)15-12-3-2-8-17-13(12)9-14(16)18-15/h2-9H,1H3 |
| InChIKey | RRGGQRKBJIVOKV-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|