About ethene;6-methoxyquinoline
ethene;6-methoxyquinoline (PubChem CID 174599262) has the molecular formula C12H13NO
and a molecular weight of 187.24 g/mol. Its IUPAC name is ethene;6-methoxyquinoline.
Molecular Properties
| Compound Name | ethene;6-methoxyquinoline |
| PubChem CID | 174599262 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | ethene;6-methoxyquinoline |
| SMILES | C=C.COc1ccc2ncccc2c1 |
| InChI | InChI=1S/C10H9NO.C2H4/c1-12-9-4-5-10-8(7-9)3-2-6-11-10;1-2/h2-7H,1H3;1-2H2 |
| InChIKey | GJCPHVJNDKEGGT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;6-methoxyquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;6-methoxyquinoline?
The IUPAC name of ethene;6-methoxyquinoline (CID 174599262) is ethene;6-methoxyquinoline.
What is the SMILES notation for ethene;6-methoxyquinoline?
The canonical SMILES for ethene;6-methoxyquinoline is C=C.COc1ccc2ncccc2c1.
What is the InChIKey of ethene;6-methoxyquinoline?
The InChIKey is GJCPHVJNDKEGGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO.C2H4/c1-12-9-4-5-10-8(7-9)3-2-6-11-10;1-2/h2-7H,1H3;1-2H2.
What are the key properties of ethene;6-methoxyquinoline?
ethene;6-methoxyquinoline has a molecular weight of 187.24 g/mol, XLogP of 3.05, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;6-methoxyquinoline is sourced from PubChem (CID 174599262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).