About 3-methoxybenzoic acid;quinoline
3-methoxybenzoic acid;quinoline (PubChem CID 67785482) has the molecular formula C17H15NO3
and a molecular weight of 281.31 g/mol. Its IUPAC name is 3-methoxybenzoic acid;quinoline.
Molecular Properties
| Compound Name | 3-methoxybenzoic acid;quinoline |
| PubChem CID | 67785482 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 3-methoxybenzoic acid;quinoline |
| SMILES | COc1cccc(C(=O)O)c1.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C8H8O3/c1-2-6-9-8(4-1)5-3-7-10-9;1-11-7-4-2-3-6(5-7)8(9)10/h1-7H;2-5H,1H3,(H,9,10) |
| InChIKey | FARALHGBLCNDCR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methoxybenzoic acid;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxybenzoic acid;quinoline?
The IUPAC name of 3-methoxybenzoic acid;quinoline (CID 67785482) is 3-methoxybenzoic acid;quinoline.
What is the SMILES notation for 3-methoxybenzoic acid;quinoline?
The canonical SMILES for 3-methoxybenzoic acid;quinoline is COc1cccc(C(=O)O)c1.c1ccc2ncccc2c1.
What is the InChIKey of 3-methoxybenzoic acid;quinoline?
The InChIKey is FARALHGBLCNDCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C8H8O3/c1-2-6-9-8(4-1)5-3-7-10-9;1-11-7-4-2-3-6(5-7)8(9)10/h1-7H;2-5H,1H3,(H,9,10).
What are the key properties of 3-methoxybenzoic acid;quinoline?
3-methoxybenzoic acid;quinoline has a molecular weight of 281.31 g/mol, XLogP of 3.63, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxybenzoic acid;quinoline is sourced from PubChem (CID 67785482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).