About ethane;quinoline-6-carboxylic acid
ethane;quinoline-6-carboxylic acid (PubChem CID 91364452) has the molecular formula C12H13NO2
and a molecular weight of 203.24 g/mol. Its IUPAC name is ethane;quinoline-6-carboxylic acid.
Molecular Properties
| Compound Name | ethane;quinoline-6-carboxylic acid |
| PubChem CID | 91364452 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | ethane;quinoline-6-carboxylic acid |
| SMILES | CC.O=C(O)c1ccc2ncccc2c1 |
| InChI | InChI=1S/C10H7NO2.C2H6/c12-10(13)8-3-4-9-7(6-8)2-1-5-11-9;1-2/h1-6H,(H,12,13);1-2H3 |
| InChIKey | ALWHTIDTFJSRRP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;quinoline-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;quinoline-6-carboxylic acid?
The IUPAC name of ethane;quinoline-6-carboxylic acid (CID 91364452) is ethane;quinoline-6-carboxylic acid.
What is the SMILES notation for ethane;quinoline-6-carboxylic acid?
The canonical SMILES for ethane;quinoline-6-carboxylic acid is CC.O=C(O)c1ccc2ncccc2c1.
What is the InChIKey of ethane;quinoline-6-carboxylic acid?
The InChIKey is ALWHTIDTFJSRRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO2.C2H6/c12-10(13)8-3-4-9-7(6-8)2-1-5-11-9;1-2/h1-6H,(H,12,13);1-2H3.
What are the key properties of ethane;quinoline-6-carboxylic acid?
ethane;quinoline-6-carboxylic acid has a molecular weight of 203.24 g/mol, XLogP of 2.96, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;quinoline-6-carboxylic acid is sourced from PubChem (CID 91364452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).