ethane;quinoline-6-carboxylic acid

C12H13NO2 — CID 91364452

IUPACethane;quinoline-6-carboxylic acid
SMILESCC.O=C(O)c1ccc2ncccc2c1
InChIInChI=1S/C10H7NO2.C2H6/c12-10(13)8-3-4-9-7(6-8)2-1-5-11-9;1-2/h1-6H,(H,12,13);1-2H3
InChIKeyALWHTIDTFJSRRP-UHFFFAOYSA-N
MW203.24 g/mol
LogP2.96
Rot. Bonds1

About ethane;quinoline-6-carboxylic acid

ethane;quinoline-6-carboxylic acid (PubChem CID 91364452) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is ethane;quinoline-6-carboxylic acid.

Molecular Properties

Compound Nameethane;quinoline-6-carboxylic acid
PubChem CID91364452
Molecular FormulaC12H13NO2
Molecular Weight203.24 g/mol
Exact Mass203.09
IUPAC Nameethane;quinoline-6-carboxylic acid
SMILESCC.O=C(O)c1ccc2ncccc2c1
InChIInChI=1S/C10H7NO2.C2H6/c12-10(13)8-3-4-9-7(6-8)2-1-5-11-9;1-2/h1-6H,(H,12,13);1-2H3
InChIKeyALWHTIDTFJSRRP-UHFFFAOYSA-N
XLogP2.96
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.24
LogP ≤ 52.96
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze ethane;quinoline-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;quinoline-6-carboxylic acid?
The IUPAC name of ethane;quinoline-6-carboxylic acid (CID 91364452) is ethane;quinoline-6-carboxylic acid.
What is the SMILES notation for ethane;quinoline-6-carboxylic acid?
The canonical SMILES for ethane;quinoline-6-carboxylic acid is CC.O=C(O)c1ccc2ncccc2c1.
What is the InChIKey of ethane;quinoline-6-carboxylic acid?
The InChIKey is ALWHTIDTFJSRRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO2.C2H6/c12-10(13)8-3-4-9-7(6-8)2-1-5-11-9;1-2/h1-6H,(H,12,13);1-2H3.
What are the key properties of ethane;quinoline-6-carboxylic acid?
ethane;quinoline-6-carboxylic acid has a molecular weight of 203.24 g/mol, XLogP of 2.96, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;quinoline-6-carboxylic acid is sourced from PubChem (CID 91364452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).