About 1-phenylpropan-1-one;quinoline
1-phenylpropan-1-one;quinoline (PubChem CID 174570718) has the molecular formula C18H17NO
and a molecular weight of 263.34 g/mol. Its IUPAC name is 1-phenylpropan-1-one;quinoline.
Molecular Properties
| Compound Name | 1-phenylpropan-1-one;quinoline |
| PubChem CID | 174570718 |
| Molecular Formula | C18H17NO |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 1-phenylpropan-1-one;quinoline |
| SMILES | CCC(=O)c1ccccc1.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C9H10O/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-9(10)8-6-4-3-5-7-8/h1-7H;3-7H,2H2,1H3 |
| InChIKey | XWBFMLRXTDBFGP-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-phenylpropan-1-one;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylpropan-1-one;quinoline?
The IUPAC name of 1-phenylpropan-1-one;quinoline (CID 174570718) is 1-phenylpropan-1-one;quinoline.
What is the SMILES notation for 1-phenylpropan-1-one;quinoline?
The canonical SMILES for 1-phenylpropan-1-one;quinoline is CCC(=O)c1ccccc1.c1ccc2ncccc2c1.
What is the InChIKey of 1-phenylpropan-1-one;quinoline?
The InChIKey is XWBFMLRXTDBFGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C9H10O/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-9(10)8-6-4-3-5-7-8/h1-7H;3-7H,2H2,1H3.
What are the key properties of 1-phenylpropan-1-one;quinoline?
1-phenylpropan-1-one;quinoline has a molecular weight of 263.34 g/mol, XLogP of 4.51, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylpropan-1-one;quinoline is sourced from PubChem (CID 174570718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).