About quinolin-6-yl methanesulfonate
quinolin-6-yl methanesulfonate (PubChem CID 157288502) has the molecular formula C20H18N2O6S2
and a molecular weight of 446.51 g/mol. Its IUPAC name is quinolin-6-yl methanesulfonate.
Molecular Properties
| Compound Name | quinolin-6-yl methanesulfonate |
| PubChem CID | 157288502 |
| Molecular Formula | C20H18N2O6S2 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | quinolin-6-yl methanesulfonate |
| SMILES | CS(=O)(=O)Oc1ccc2ncccc2c1.CS(=O)(=O)Oc1ccc2ncccc2c1 |
| InChI | InChI=1S/2C10H9NO3S/c2*1-15(12,13)14-9-4-5-10-8(7-9)3-2-6-11-10/h2*2-7H,1H3 |
| InChIKey | BANCHTJQLIKRPY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 112.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze quinolin-6-yl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-6-yl methanesulfonate?
The IUPAC name of quinolin-6-yl methanesulfonate (CID 157288502) is quinolin-6-yl methanesulfonate.
What is the SMILES notation for quinolin-6-yl methanesulfonate?
The canonical SMILES for quinolin-6-yl methanesulfonate is CS(=O)(=O)Oc1ccc2ncccc2c1.CS(=O)(=O)Oc1ccc2ncccc2c1.
What is the InChIKey of quinolin-6-yl methanesulfonate?
The InChIKey is BANCHTJQLIKRPY-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H9NO3S/c2*1-15(12,13)14-9-4-5-10-8(7-9)3-2-6-11-10/h2*2-7H,1H3.
What are the key properties of quinolin-6-yl methanesulfonate?
quinolin-6-yl methanesulfonate has a molecular weight of 446.51 g/mol, XLogP of 3.15, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-6-yl methanesulfonate is sourced from PubChem (CID 157288502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).