About quinoline-6-sulfonamide
quinoline-6-sulfonamide (PubChem CID 23273907) has the molecular formula C9H8N2O2S
and a molecular weight of 208.24 g/mol. Its IUPAC name is quinoline-6-sulfonamide.
Molecular Properties
| Compound Name | quinoline-6-sulfonamide |
| PubChem CID | 23273907 |
| Molecular Formula | C9H8N2O2S |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | quinoline-6-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H8N2O2S/c10-14(12,13)8-3-4-9-7(6-8)2-1-5-11-9/h1-6H,(H2,10,12,13) |
| InChIKey | ZSJVRUWXJDVHQI-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze quinoline-6-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinoline-6-sulfonamide?
The IUPAC name of quinoline-6-sulfonamide (CID 23273907) is quinoline-6-sulfonamide.
What is the SMILES notation for quinoline-6-sulfonamide?
The canonical SMILES for quinoline-6-sulfonamide is NS(=O)(=O)c1ccc2ncccc2c1.
What is the InChIKey of quinoline-6-sulfonamide?
The InChIKey is ZSJVRUWXJDVHQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2S/c10-14(12,13)8-3-4-9-7(6-8)2-1-5-11-9/h1-6H,(H2,10,12,13).
What are the key properties of quinoline-6-sulfonamide?
quinoline-6-sulfonamide has a molecular weight of 208.24 g/mol, XLogP of 0.88, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for quinoline-6-sulfonamide is sourced from PubChem (CID 23273907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).