C15H16N2O2S — CID 167907378
6-[[(1R,5S)-3-azabicyclo[3.2.0]heptan-3-yl]sulfonyl]quinoline (PubChem CID 167907378) has the molecular formula C15H16N2O2S and a molecular weight of 288.37 g/mol. Its IUPAC name is 6-[[(1R,5S)-3-azabicyclo[3.2.0]heptan-3-yl]sulfonyl]quinoline.
| Compound Name | 6-[[(1R,5S)-3-azabicyclo[3.2.0]heptan-3-yl]sulfonyl]quinoline |
|---|---|
| PubChem CID | 167907378 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 6-[[(1R,5S)-3-azabicyclo[3.2.0]heptan-3-yl]sulfonyl]quinoline |
| SMILES | O=S(=O)(c1ccc2ncccc2c1)N1C[C@H]2CC[C@H]2C1 |
| InChI | InChI=1S/C15H16N2O2S/c18-20(19,17-9-12-3-4-13(12)10-17)14-5-6-15-11(8-14)2-1-7-16-15/h1-2,5-8,12-13H,3-4,9-10H2/t12-,13+ |
| InChIKey | GLAWACZEAUYCDE-BETUJISGSA-N |
| XLogP | 2.27 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |