C16H20N2O3S — CID 95775848
N-ethyl-N-[[(3S)-oxolan-3-yl]methyl]quinoline-6-sulfonamide (PubChem CID 95775848) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is N-ethyl-N-[[(3S)-oxolan-3-yl]methyl]quinoline-6-sulfonamide.
| Compound Name | N-ethyl-N-[[(3S)-oxolan-3-yl]methyl]quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 95775848 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | N-ethyl-N-[[(3S)-oxolan-3-yl]methyl]quinoline-6-sulfonamide |
| SMILES | CCN(C[C@@H]1CCOC1)S(=O)(=O)c1ccc2ncccc2c1 |
| InChI | InChI=1S/C16H20N2O3S/c1-2-18(11-13-7-9-21-12-13)22(19,20)15-5-6-16-14(10-15)4-3-8-17-16/h3-6,8,10,13H,2,7,9,11-12H2,1H3/t13-/m0/s1 |
| InChIKey | YFTIBTPXTMMFQJ-ZDUSSCGKSA-N |
| XLogP | 2.28 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |