C11H15ClN2O2S — CID 63957203
2-chloro-N-(cyclopropylmethyl)-N-ethylpyridine-4-sulfonamide (PubChem CID 63957203) has the molecular formula C11H15ClN2O2S and a molecular weight of 274.77 g/mol. Its IUPAC name is 2-chloro-N-(cyclopropylmethyl)-N-ethylpyridine-4-sulfonamide.
| Compound Name | 2-chloro-N-(cyclopropylmethyl)-N-ethylpyridine-4-sulfonamide |
|---|---|
| PubChem CID | 63957203 |
| Molecular Formula | C11H15ClN2O2S |
| Molecular Weight | 274.77 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 2-chloro-N-(cyclopropylmethyl)-N-ethylpyridine-4-sulfonamide |
| SMILES | CCN(CC1CC1)S(=O)(=O)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C11H15ClN2O2S/c1-2-14(8-9-3-4-9)17(15,16)10-5-6-13-11(12)7-10/h5-7,9H,2-4,8H2,1H3 |
| InChIKey | XIMFQUOYTKFYPT-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.77 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|