C10H14ClN3O3S — CID 61053217
2-[(2-chloro-4-pyridinyl)sulfonyl-ethylamino]-N-methylacetamide (PubChem CID 61053217) has the molecular formula C10H14ClN3O3S and a molecular weight of 291.76 g/mol. Its IUPAC name is 2-[(2-chloro-4-pyridinyl)sulfonyl-ethylamino]-N-methylacetamide.
| Compound Name | 2-[(2-chloro-4-pyridinyl)sulfonyl-ethylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 61053217 |
| Molecular Formula | C10H14ClN3O3S |
| Molecular Weight | 291.76 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 2-[(2-chloro-4-pyridinyl)sulfonyl-ethylamino]-N-methylacetamide |
| SMILES | CCN(CC(=O)NC)S(=O)(=O)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C10H14ClN3O3S/c1-3-14(7-10(15)12-2)18(16,17)8-4-5-13-9(11)6-8/h4-6H,3,7H2,1-2H3,(H,12,15) |
| InChIKey | OBJMLYVNUUJJTC-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.76 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|