C12H19N3O5S2 — CID 49240452
2-[ethyl-[3-(methylsulfamoyl)phenyl]sulfonylamino]-N-methylacetamide (PubChem CID 49240452) has the molecular formula C12H19N3O5S2 and a molecular weight of 349.43 g/mol. Its IUPAC name is 2-[ethyl-[3-(methylsulfamoyl)phenyl]sulfonylamino]-N-methylacetamide.
| Compound Name | 2-[ethyl-[3-(methylsulfamoyl)phenyl]sulfonylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 49240452 |
| Molecular Formula | C12H19N3O5S2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 2-[ethyl-[3-(methylsulfamoyl)phenyl]sulfonylamino]-N-methylacetamide |
| SMILES | CCN(CC(=O)NC)S(=O)(=O)c1cccc(S(=O)(=O)NC)c1 |
| InChI | InChI=1S/C12H19N3O5S2/c1-4-15(9-12(16)13-2)22(19,20)11-7-5-6-10(8-11)21(17,18)14-3/h5-8,14H,4,9H2,1-3H3,(H,13,16) |
| InChIKey | CBJNXPKROQHITG-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |