C10H13Cl2N3O3S — CID 64608953
2-[(5,6-dichloro-3-pyridinyl)sulfonyl-ethylamino]-N-methylacetamide (PubChem CID 64608953) has the molecular formula C10H13Cl2N3O3S and a molecular weight of 326.21 g/mol. Its IUPAC name is 2-[(5,6-dichloro-3-pyridinyl)sulfonyl-ethylamino]-N-methylacetamide.
| Compound Name | 2-[(5,6-dichloro-3-pyridinyl)sulfonyl-ethylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 64608953 |
| Molecular Formula | C10H13Cl2N3O3S |
| Molecular Weight | 326.21 g/mol |
| Exact Mass | 325.01 |
| IUPAC Name | 2-[(5,6-dichloro-3-pyridinyl)sulfonyl-ethylamino]-N-methylacetamide |
| SMILES | CCN(CC(=O)NC)S(=O)(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H13Cl2N3O3S/c1-3-15(6-9(16)13-2)19(17,18)7-4-8(11)10(12)14-5-7/h4-5H,3,6H2,1-2H3,(H,13,16) |
| InChIKey | KCTKYEGKHBQYJH-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.21 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|