C20H27Cl3N6O8S2 — CID 160881864
ethyl 2-[(5-chloro-6-hydrazinyl-3-pyridinyl)sulfonyl-methylamino]acetate;ethyl 2-[(5,6-dichloro-3-pyridinyl)sulfonyl-methylamino]acetate (PubChem CID 160881864) has the molecular formula C20H27Cl3N6O8S2 and a molecular weight of 649.96 g/mol. Its IUPAC name is ethyl 2-[(5-chloro-6-hydrazinyl-3-pyridinyl)sulfonyl-methylamino]acetate;ethyl 2-[(5,6-dichloro-3-pyridinyl)sulfonyl-methylamino]acetate.
| Compound Name | ethyl 2-[(5-chloro-6-hydrazinyl-3-pyridinyl)sulfonyl-methylamino]acetate;ethyl 2-[(5,6-dichloro-3-pyridinyl)sulfonyl-methylamino]acetate |
|---|---|
| PubChem CID | 160881864 |
| Molecular Formula | C20H27Cl3N6O8S2 |
| Molecular Weight | 649.96 g/mol |
| Exact Mass | 648.04 |
| IUPAC Name | ethyl 2-[(5-chloro-6-hydrazinyl-3-pyridinyl)sulfonyl-methylamino]acetate;ethyl 2-[(5,6-dichloro-3-pyridinyl)sulfonyl-methylamino]acetate |
| SMILES | CCOC(=O)CN(C)S(=O)(=O)c1cnc(Cl)c(Cl)c1.CCOC(=O)CN(C)S(=O)(=O)c1cnc(NN)c(Cl)c1 |
| InChI | InChI=1S/C10H12Cl2N2O4S.C10H15ClN4O4S/c1-3-18-9(15)6-14(2)19(16,17)7-4-8(11)10(12)13-5-7;1-3-19-9(16)6-15(2)20(17,18)7-4-8(11)10(14-12)13-5-7/h4-5H,3,6H2,1-2H3;4-5H,3,6,12H2,1-2H3,(H,13,14) |
| InChIKey | SNDHAPIAGXSQHA-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 191.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.96 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|