C12H21ClN4O2S — CID 64606467
5-chloro-6-hydrazinyl-N-methyl-N-(4-methylpentan-2-yl)pyridine-3-sulfonamide (PubChem CID 64606467) has the molecular formula C12H21ClN4O2S and a molecular weight of 320.85 g/mol. Its IUPAC name is 5-chloro-6-hydrazinyl-N-methyl-N-(4-methylpentan-2-yl)pyridine-3-sulfonamide.
| Compound Name | 5-chloro-6-hydrazinyl-N-methyl-N-(4-methylpentan-2-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64606467 |
| Molecular Formula | C12H21ClN4O2S |
| Molecular Weight | 320.85 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 5-chloro-6-hydrazinyl-N-methyl-N-(4-methylpentan-2-yl)pyridine-3-sulfonamide |
| SMILES | CC(C)CC(C)N(C)S(=O)(=O)c1cnc(NN)c(Cl)c1 |
| InChI | InChI=1S/C12H21ClN4O2S/c1-8(2)5-9(3)17(4)20(18,19)10-6-11(13)12(16-14)15-7-10/h6-9H,5,14H2,1-4H3,(H,15,16) |
| InChIKey | JTLNUMBEZSDCNL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.85 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|