C10H14Cl2N2O2S — CID 64625358
N-butyl-5,6-dichloro-N-methylpyridine-3-sulfonamide (PubChem CID 64625358) has the molecular formula C10H14Cl2N2O2S and a molecular weight of 297.21 g/mol. Its IUPAC name is N-butyl-5,6-dichloro-N-methylpyridine-3-sulfonamide.
| Compound Name | N-butyl-5,6-dichloro-N-methylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64625358 |
| Molecular Formula | C10H14Cl2N2O2S |
| Molecular Weight | 297.21 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | N-butyl-5,6-dichloro-N-methylpyridine-3-sulfonamide |
| SMILES | CCCCN(C)S(=O)(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H14Cl2N2O2S/c1-3-4-5-14(2)17(15,16)8-6-9(11)10(12)13-7-8/h6-7H,3-5H2,1-2H3 |
| InChIKey | HZPFSMLWJSSRAX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.21 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|