C10H14Cl2N2O3S — CID 64608229
5,6-dichloro-N-(3-methoxypropyl)-N-methylpyridine-3-sulfonamide (PubChem CID 64608229) has the molecular formula C10H14Cl2N2O3S and a molecular weight of 313.21 g/mol. Its IUPAC name is 5,6-dichloro-N-(3-methoxypropyl)-N-methylpyridine-3-sulfonamide.
| Compound Name | 5,6-dichloro-N-(3-methoxypropyl)-N-methylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64608229 |
| Molecular Formula | C10H14Cl2N2O3S |
| Molecular Weight | 313.21 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | 5,6-dichloro-N-(3-methoxypropyl)-N-methylpyridine-3-sulfonamide |
| SMILES | COCCCN(C)S(=O)(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H14Cl2N2O3S/c1-14(4-3-5-17-2)18(15,16)8-6-9(11)10(12)13-7-8/h6-7H,3-5H2,1-2H3 |
| InChIKey | KLTILYXXAIBKIO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.21 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|