C10H14Cl2N2O4S — CID 64608793
5,6-dichloro-N-(2-hydroxy-3-methoxypropyl)-N-methylpyridine-3-sulfonamide (PubChem CID 64608793) has the molecular formula C10H14Cl2N2O4S and a molecular weight of 329.21 g/mol. Its IUPAC name is 5,6-dichloro-N-(2-hydroxy-3-methoxypropyl)-N-methylpyridine-3-sulfonamide.
| Compound Name | 5,6-dichloro-N-(2-hydroxy-3-methoxypropyl)-N-methylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64608793 |
| Molecular Formula | C10H14Cl2N2O4S |
| Molecular Weight | 329.21 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | 5,6-dichloro-N-(2-hydroxy-3-methoxypropyl)-N-methylpyridine-3-sulfonamide |
| SMILES | COCC(O)CN(C)S(=O)(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H14Cl2N2O4S/c1-14(5-7(15)6-18-2)19(16,17)8-3-9(11)10(12)13-4-8/h3-4,7,15H,5-6H2,1-2H3 |
| InChIKey | KNHUUEFZWBIPHW-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.21 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|