C11H15N3O4S — CID 115875810
6-cyano-N-(2-hydroxy-3-methoxypropyl)-N-methylpyridine-3-sulfonamide (PubChem CID 115875810) has the molecular formula C11H15N3O4S and a molecular weight of 285.33 g/mol. Its IUPAC name is 6-cyano-N-(2-hydroxy-3-methoxypropyl)-N-methylpyridine-3-sulfonamide.
| Compound Name | 6-cyano-N-(2-hydroxy-3-methoxypropyl)-N-methylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 115875810 |
| Molecular Formula | C11H15N3O4S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 6-cyano-N-(2-hydroxy-3-methoxypropyl)-N-methylpyridine-3-sulfonamide |
| SMILES | COCC(O)CN(C)S(=O)(=O)c1ccc(C#N)nc1 |
| InChI | InChI=1S/C11H15N3O4S/c1-14(7-10(15)8-18-2)19(16,17)11-4-3-9(5-12)13-6-11/h3-4,6,10,15H,7-8H2,1-2H3 |
| InChIKey | AFLSRCGMAQVIMY-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 103.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |