C14H14N4O2S — CID 114612849
N-[(4-aminophenyl)methyl]-6-cyano-N-methylpyridine-3-sulfonamide (PubChem CID 114612849) has the molecular formula C14H14N4O2S and a molecular weight of 302.36 g/mol. Its IUPAC name is N-[(4-aminophenyl)methyl]-6-cyano-N-methylpyridine-3-sulfonamide.
| Compound Name | N-[(4-aminophenyl)methyl]-6-cyano-N-methylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 114612849 |
| Molecular Formula | C14H14N4O2S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | N-[(4-aminophenyl)methyl]-6-cyano-N-methylpyridine-3-sulfonamide |
| SMILES | CN(Cc1ccc(N)cc1)S(=O)(=O)c1ccc(C#N)nc1 |
| InChI | InChI=1S/C14H14N4O2S/c1-18(10-11-2-4-12(16)5-3-11)21(19,20)14-7-6-13(8-15)17-9-14/h2-7,9H,10,16H2,1H3 |
| InChIKey | HOJUBIJXVOPOQX-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 100.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|