C10H13N3O2S2 — CID 115690499
6-cyano-N-methyl-N-(2-methylsulfanylethyl)pyridine-3-sulfonamide (PubChem CID 115690499) has the molecular formula C10H13N3O2S2 and a molecular weight of 271.37 g/mol. Its IUPAC name is 6-cyano-N-methyl-N-(2-methylsulfanylethyl)pyridine-3-sulfonamide.
| Compound Name | 6-cyano-N-methyl-N-(2-methylsulfanylethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 115690499 |
| Molecular Formula | C10H13N3O2S2 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 6-cyano-N-methyl-N-(2-methylsulfanylethyl)pyridine-3-sulfonamide |
| SMILES | CSCCN(C)S(=O)(=O)c1ccc(C#N)nc1 |
| InChI | InChI=1S/C10H13N3O2S2/c1-13(5-6-16-2)17(14,15)10-4-3-9(7-11)12-8-10/h3-4,8H,5-6H2,1-2H3 |
| InChIKey | GNQXNCLRJIVONB-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 74.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |